C15H24N4O8S — CID 90423278
[(2S,5R)-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate (PubChem CID 90423278) has the molecular formula C15H24N4O8S and a molecular weight of 420.44 g/mol. Its IUPAC name is [(2S,5R)-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90423278 |
| Molecular Formula | C15H24N4O8S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [(2S,5R)-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
| SMILES | CNC1CCCC1ONC(=O)[C@@H]1CC2(COC2)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H24N4O8S/c1-16-9-3-2-4-11(9)26-17-13(20)10-5-15(7-25-8-15)12-6-18(10)14(21)19(12)27-28(22,23)24/h9-12,16H,2-8H2,1H3,(H,17,20)(H,22,23,24)/t9?,10-,11?,12-/m0/s1 |
| InChIKey | ZLDIIWAQROQVFM-ADPBJBESSA-N |
| XLogP | -1.20 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|