C16H21N5O8S — CID 78426158
[(2S,5R)-2-[(2-amino-2-pyridin-2-ylethoxy)carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate (PubChem CID 78426158) has the molecular formula C16H21N5O8S and a molecular weight of 443.44 g/mol. Its IUPAC name is [(2S,5R)-2-[(2-amino-2-pyridin-2-ylethoxy)carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[(2-amino-2-pyridin-2-ylethoxy)carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78426158 |
| Molecular Formula | C16H21N5O8S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [(2S,5R)-2-[(2-amino-2-pyridin-2-ylethoxy)carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
| SMILES | NC(CONC(=O)[C@@H]1CC2(COC2)[C@@H]2CN1C(=O)N2OS(=O)(=O)O)c1ccccn1 |
| InChI | InChI=1S/C16H21N5O8S/c17-10(11-3-1-2-4-18-11)7-28-19-14(22)12-5-16(8-27-9-16)13-6-20(12)15(23)21(13)29-30(24,25)26/h1-4,10,12-13H,5-9,17H2,(H,19,22)(H,24,25,26)/t10?,12-,13-/m0/s1 |
| InChIKey | NWWLUJZUWAJWSM-OLPBLLBXSA-N |
| XLogP | -1.24 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|