C13H20N4O8S — CID 123828699
[2-[[2-(methylamino)cyclopropyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate (PubChem CID 123828699) has the molecular formula C13H20N4O8S and a molecular weight of 392.39 g/mol. Its IUPAC name is [2-[[2-(methylamino)cyclopropyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate.
| Compound Name | [2-[[2-(methylamino)cyclopropyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123828699 |
| Molecular Formula | C13H20N4O8S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [2-[[2-(methylamino)cyclopropyl]oxycarbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
| SMILES | CNC1CC1ONC(=O)C1CC2(COC2)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H20N4O8S/c1-14-7-2-9(7)24-15-11(18)8-3-13(5-23-6-13)10-4-16(8)12(19)17(10)25-26(20,21)22/h7-10,14H,2-6H2,1H3,(H,15,18)(H,20,21,22) |
| InChIKey | KBMVVJKPCIUPFJ-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|