C14H22N4O8S — CID 90423289
[(2S,5R)-7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate (PubChem CID 90423289) has the molecular formula C14H22N4O8S and a molecular weight of 406.42 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90423289 |
| Molecular Formula | C14H22N4O8S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [(2S,5R)-7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC1CCCNC1)[C@@H]1CC2(COC2)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H22N4O8S/c19-12(16-25-9-2-1-3-15-5-9)10-4-14(7-24-8-14)11-6-17(10)13(20)18(11)26-27(21,22)23/h9-11,15H,1-8H2,(H,16,19)(H,21,22,23)/t9?,10-,11-/m0/s1 |
| InChIKey | XFLLWEQKZBIWJH-DVRYWGNFSA-N |
| XLogP | -1.58 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|