C15H22N4O8S — CID 90422285
[(2S,5R)-2-[[(2,2-dimethylcyclopropanecarbonyl)amino]carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate (PubChem CID 90422285) has the molecular formula C15H22N4O8S and a molecular weight of 418.43 g/mol. Its IUPAC name is [(2S,5R)-2-[[(2,2-dimethylcyclopropanecarbonyl)amino]carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[[(2,2-dimethylcyclopropanecarbonyl)amino]carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90422285 |
| Molecular Formula | C15H22N4O8S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [(2S,5R)-2-[[(2,2-dimethylcyclopropanecarbonyl)amino]carbamoyl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,3'-oxetane]-6-yl] hydrogen sulfate |
| SMILES | CC1(C)CC1C(=O)NNC(=O)[C@@H]1CC2(COC2)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H22N4O8S/c1-14(2)3-8(14)11(20)16-17-12(21)9-4-15(6-26-7-15)10-5-18(9)13(22)19(10)27-28(23,24)25/h8-10H,3-7H2,1-2H3,(H,16,20)(H,17,21)(H,23,24,25)/t8?,9-,10-/m0/s1 |
| InChIKey | DCACHWKMQAKKHB-AGROOBSYSA-N |
| XLogP | -1.19 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|