C12H18F2N4O8S — CID 123683130
[2-[(3-aminooxolan-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 123683130) has the molecular formula C12H18F2N4O8S and a molecular weight of 416.36 g/mol. Its IUPAC name is [2-[(3-aminooxolan-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[(3-aminooxolan-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123683130 |
| Molecular Formula | C12H18F2N4O8S |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [2-[(3-aminooxolan-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC1(CONC(=O)C2CC(F)(F)C3CN2C(=O)N3OS(=O)(=O)O)CCOC1 |
| InChI | InChI=1S/C12H18F2N4O8S/c13-12(14)3-7(9(19)16-25-6-11(15)1-2-24-5-11)17-4-8(12)18(10(17)20)26-27(21,22)23/h7-8H,1-6,15H2,(H,16,19)(H,21,22,23) |
| InChIKey | AHSDOCJRPGPEPT-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|