C13H18F2N6O7S — CID 78427926
[(2S,5S)-2-[[2-amino-2-(1-methylimidazol-2-yl)ethoxy]carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 78427926) has the molecular formula C13H18F2N6O7S and a molecular weight of 440.39 g/mol. Its IUPAC name is [(2S,5S)-2-[[2-amino-2-(1-methylimidazol-2-yl)ethoxy]carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5S)-2-[[2-amino-2-(1-methylimidazol-2-yl)ethoxy]carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78427926 |
| Molecular Formula | C13H18F2N6O7S |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [(2S,5S)-2-[[2-amino-2-(1-methylimidazol-2-yl)ethoxy]carbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Cn1ccnc1C(N)CONC(=O)[C@@H]1CC(F)(F)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H18F2N6O7S/c1-19-3-2-17-10(19)7(16)6-27-18-11(22)8-4-13(14,15)9-5-20(8)12(23)21(9)28-29(24,25)26/h2-3,7-9H,4-6,16H2,1H3,(H,18,22)(H,24,25,26)/t7?,8-,9-/m0/s1 |
| InChIKey | GPPGXRFJRFLFFD-NPPUSCPJSA-N |
| XLogP | -1.28 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|