C12H17N5O7S — CID 155337706
[(2S,5R)-2-[5-[(1S)-2-amino-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate (PubChem CID 155337706) has the molecular formula C12H17N5O7S and a molecular weight of 375.36 g/mol. Its IUPAC name is [(2S,5R)-2-[5-[(1S)-2-amino-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[5-[(1S)-2-amino-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 155337706 |
| Molecular Formula | C12H17N5O7S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [(2S,5R)-2-[5-[(1S)-2-amino-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
| SMILES | NC[C@H](O)c1nnc([C@@H]2CC3(CC3)[C@@H]3CN2C(=O)N3OS(=O)(=O)O)o1 |
| InChI | InChI=1S/C12H17N5O7S/c13-4-7(18)10-15-14-9(23-10)6-3-12(1-2-12)8-5-16(6)11(19)17(8)24-25(20,21)22/h6-8,18H,1-5,13H2,(H,20,21,22)/t6-,7-,8-/m0/s1 |
| InChIKey | CLIXVPQKHOBOMS-FXQIFTODSA-N |
| XLogP | -0.87 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|