C10H17ClN2O — CID 155344836
7-methylidene-1,2,3,4,6,8,9,9a-octahydropyrido[1,2-a]pyrazine-6-carbaldehyde;hydrochloride (PubChem CID 155344836) has the molecular formula C10H17ClN2O and a molecular weight of 216.71 g/mol. Its IUPAC name is 7-methylidene-1,2,3,4,6,8,9,9a-octahydropyrido[1,2-a]pyrazine-6-carbaldehyde;hydrochloride.
| Compound Name | 7-methylidene-1,2,3,4,6,8,9,9a-octahydropyrido[1,2-a]pyrazine-6-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 155344836 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 7-methylidene-1,2,3,4,6,8,9,9a-octahydropyrido[1,2-a]pyrazine-6-carbaldehyde;hydrochloride |
| SMILES | C=C1CCC2CNCCN2C1C=O.Cl |
| InChI | InChI=1S/C10H16N2O.ClH/c1-8-2-3-9-6-11-4-5-12(9)10(8)7-13;/h7,9-11H,1-6H2;1H |
| InChIKey | DSBSLOKYJAHHJY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|