C22H16F5N3O4 — CID 155351339
3-[7-fluoro-3-oxo-6-[(3R)-4,4,4-trifluoro-3-(3-fluoro-2-pyridinyl)butanoyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155351339) has the molecular formula C22H16F5N3O4 and a molecular weight of 481.38 g/mol. Its IUPAC name is 3-[7-fluoro-3-oxo-6-[(3R)-4,4,4-trifluoro-3-(3-fluoro-2-pyridinyl)butanoyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-fluoro-3-oxo-6-[(3R)-4,4,4-trifluoro-3-(3-fluoro-2-pyridinyl)butanoyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155351339 |
| Molecular Formula | C22H16F5N3O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 3-[7-fluoro-3-oxo-6-[(3R)-4,4,4-trifluoro-3-(3-fluoro-2-pyridinyl)butanoyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(C(=O)C[C@H](c4ncccc4F)C(F)(F)F)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H16F5N3O4/c23-14-2-1-7-28-19(14)13(22(25,26)27)8-16(31)11-4-3-10-12(18(11)24)9-30(21(10)34)15-5-6-17(32)29-20(15)33/h1-4,7,13,15H,5-6,8-9H2,(H,29,32,33)/t13-,15?/m1/s1 |
| InChIKey | XPJUXPDWUITETR-AFYYWNPRSA-N |
| XLogP | 3.04 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|