About tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate
tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate (PubChem CID 155354427) has the molecular formula C18H18N4O4
and a molecular weight of 354.37 g/mol. Its IUPAC name is tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate |
| PubChem CID | 155354427 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(n2nnc3c2C(=O)C(=O)c2ccccc2-3)C1 |
| InChI | InChI=1S/C18H18N4O4/c1-18(2,3)26-17(25)21-8-10(9-21)22-14-13(19-20-22)11-6-4-5-7-12(11)15(23)16(14)24/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | OGPVFJVKPMPVKN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate?
The IUPAC name of tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate (CID 155354427) is tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate is CC(C)(C)OC(=O)N1CC(n2nnc3c2C(=O)C(=O)c2ccccc2-3)C1.
What is the InChIKey of tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate?
The InChIKey is OGPVFJVKPMPVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O4/c1-18(2,3)26-17(25)21-8-10(9-21)22-14-13(19-20-22)11-6-4-5-7-12(11)15(23)16(14)24/h4-7,10H,8-9H2,1-3H3.
What are the key properties of tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate?
tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate has a molecular weight of 354.37 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(4,5-dioxobenzo[e]benzotriazol-3-yl)azetidine-1-carboxylate is sourced from PubChem (CID 155354427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).