C29H30Cl2N6O2 — CID 155355406
N'-[[[(6-chloro-2-methoxyacridin-9-yl)amino]methyl-methylamino]methoxymethyl]-N-(7-chloroquinolin-4-yl)-N'-methylmethanediamine (PubChem CID 155355406) has the molecular formula C29H30Cl2N6O2 and a molecular weight of 565.51 g/mol. Its IUPAC name is N'-[[[(6-chloro-2-methoxyacridin-9-yl)amino]methyl-methylamino]methoxymethyl]-N-(7-chloroquinolin-4-yl)-N'-methylmethanediamine.
| Compound Name | N'-[[[(6-chloro-2-methoxyacridin-9-yl)amino]methyl-methylamino]methoxymethyl]-N-(7-chloroquinolin-4-yl)-N'-methylmethanediamine |
|---|---|
| PubChem CID | 155355406 |
| Molecular Formula | C29H30Cl2N6O2 |
| Molecular Weight | 565.51 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | N'-[[[(6-chloro-2-methoxyacridin-9-yl)amino]methyl-methylamino]methoxymethyl]-N-(7-chloroquinolin-4-yl)-N'-methylmethanediamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCN(C)COCN(C)CNc3ccnc4cc(Cl)ccc34)c2c1 |
| InChI | InChI=1S/C29H30Cl2N6O2/c1-36(15-33-25-10-11-32-27-12-19(30)4-7-22(25)27)17-39-18-37(2)16-34-29-23-8-5-20(31)13-28(23)35-26-9-6-21(38-3)14-24(26)29/h4-14H,15-18H2,1-3H3,(H,32,33)(H,34,35) |
| InChIKey | YBHYGKLYILXDKC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|