C13H15FN4OS2 — CID 155357266
N-[5-[3-[(4-fluorophenyl)sulfanylamino]propyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 155357266) has the molecular formula C13H15FN4OS2 and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[5-[3-[(4-fluorophenyl)sulfanylamino]propyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[3-[(4-fluorophenyl)sulfanylamino]propyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 155357266 |
| Molecular Formula | C13H15FN4OS2 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-[5-[3-[(4-fluorophenyl)sulfanylamino]propyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(CCCNSc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C13H15FN4OS2/c1-9(19)16-13-18-17-12(20-13)3-2-8-15-21-11-6-4-10(14)5-7-11/h4-7,15H,2-3,8H2,1H3,(H,16,18,19) |
| InChIKey | XGUVNWWOFCYBBE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|