C8H9N3OS — CID 174996359
N-(5-but-3-ynyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 174996359) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is N-(5-but-3-ynyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | N-(5-but-3-ynyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 174996359 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | N-(5-but-3-ynyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C#CCCc1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C8H9N3OS/c1-3-4-5-7-10-11-8(13-7)9-6(2)12/h1H,4-5H2,2H3,(H,9,11,12) |
| InChIKey | JICANBQJEHNORJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|