C12H16N8O4S2 — CID 2016945
N-[5-[2-[2-(5-acetamido-1,3,4-thiadiazol-2-yl)ethyl-nitroamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 2016945) has the molecular formula C12H16N8O4S2 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[5-[2-[2-(5-acetamido-1,3,4-thiadiazol-2-yl)ethyl-nitroamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-[2-(5-acetamido-1,3,4-thiadiazol-2-yl)ethyl-nitroamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2016945 |
| Molecular Formula | C12H16N8O4S2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-[5-[2-[2-(5-acetamido-1,3,4-thiadiazol-2-yl)ethyl-nitroamino]ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(CCN(CCc2nnc(NC(C)=O)s2)[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H16N8O4S2/c1-7(21)13-11-17-15-9(25-11)3-5-19(20(23)24)6-4-10-16-18-12(26-10)14-8(2)22/h3-6H2,1-2H3,(H,13,17,21)(H,14,18,22) |
| InChIKey | CDHMYDDRYQILLE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 156.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|