C13H19IN4 — CID 155357699
2-[5-(iodomethyl)pyrimidin-2-yl]-7-methyl-2,7-diazaspiro[3.5]nonane (PubChem CID 155357699) has the molecular formula C13H19IN4 and a molecular weight of 358.23 g/mol. Its IUPAC name is 2-[5-(iodomethyl)pyrimidin-2-yl]-7-methyl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 2-[5-(iodomethyl)pyrimidin-2-yl]-7-methyl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 155357699 |
| Molecular Formula | C13H19IN4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[5-(iodomethyl)pyrimidin-2-yl]-7-methyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CN1CCC2(CC1)CN(c1ncc(CI)cn1)C2 |
| InChI | InChI=1S/C13H19IN4/c1-17-4-2-13(3-5-17)9-18(10-13)12-15-7-11(6-14)8-16-12/h7-8H,2-6,9-10H2,1H3 |
| InChIKey | BXCISNNDHHXWNN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|