About ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane
ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane (PubChem CID 171069701) has the molecular formula C15H26N4
and a molecular weight of 262.40 g/mol. Its IUPAC name is ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 171069701 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.Cc1cnc(N2CC3(CCN(C)CC3)C2)nc1 |
| InChI | InChI=1S/C13H20N4.C2H6/c1-11-7-14-12(15-8-11)17-9-13(10-17)3-5-16(2)6-4-13;1-2/h7-8H,3-6,9-10H2,1-2H3;1-2H3 |
| InChIKey | KOUVBEVQKIUYLE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane?
The IUPAC name of ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane (CID 171069701) is ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane is CC.Cc1cnc(N2CC3(CCN(C)CC3)C2)nc1.
What is the InChIKey of ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane?
The InChIKey is KOUVBEVQKIUYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4.C2H6/c1-11-7-14-12(15-8-11)17-9-13(10-17)3-5-16(2)6-4-13;1-2/h7-8H,3-6,9-10H2,1-2H3;1-2H3.
What are the key properties of ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane?
ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane has a molecular weight of 262.40 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-2-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 171069701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).