C23H36O — CID 155359271
(2S,3R,5S,8R,10R,13S)-2,3,13-trimethyl-5-prop-2-enyl-1,2,3,4,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 155359271) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is (2S,3R,5S,8R,10R,13S)-2,3,13-trimethyl-5-prop-2-enyl-1,2,3,4,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (2S,3R,5S,8R,10R,13S)-2,3,13-trimethyl-5-prop-2-enyl-1,2,3,4,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 155359271 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | (2S,3R,5S,8R,10R,13S)-2,3,13-trimethyl-5-prop-2-enyl-1,2,3,4,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C=CC[C@]12CC[C@@H]3C(CC[C@]4(C)C(=O)CCC34)[C@H]1C[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C23H36O/c1-5-10-23-12-9-17-18(20(23)13-15(2)16(3)14-23)8-11-22(4)19(17)6-7-21(22)24/h5,15-20H,1,6-14H2,2-4H3/t15-,16+,17+,18?,19?,20+,22-,23+/m0/s1 |
| InChIKey | JCHWVCWGZITGRZ-KOCJRXNVSA-N |
| XLogP | 6.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|