C31H36ClN3O6 — CID 155367847
(Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butyl-methylamino]-N-methyl-N-prop-2-ynoxybut-2-enamide (PubChem CID 155367847) has the molecular formula C31H36ClN3O6 and a molecular weight of 582.10 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butyl-methylamino]-N-methyl-N-prop-2-ynoxybut-2-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butyl-methylamino]-N-methyl-N-prop-2-ynoxybut-2-enamide |
|---|---|
| PubChem CID | 155367847 |
| Molecular Formula | C31H36ClN3O6 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-4-[4-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)butyl-methylamino]-N-methyl-N-prop-2-ynoxybut-2-enamide |
| SMILES | C#CCON(C)C(=O)/C=C/CN(C)CCCCN1c2ccccc2CCc2ccc(Cl)cc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C27H32ClN3O2.C4H4O4/c1-4-20-33-30(3)27(32)12-9-18-29(2)17-7-8-19-31-25-11-6-5-10-22(25)13-14-23-15-16-24(28)21-26(23)31;5-3(6)1-2-4(7)8/h1,5-6,9-12,15-16,21H,7-8,13-14,17-20H2,2-3H3;1-2H,(H,5,6)(H,7,8)/b12-9+;2-1- |
| InChIKey | GQPDPRSFKDNMOX-IEJMETINSA-N |
| XLogP | 4.58 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|