C20H36O18P2S4 — CID 155384257
4-[4-bis[(4-methyl-2,2-dioxooxathiolan-4-yl)oxy]phosphorylbutyl-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]oxy-4-methyloxathiolane 2,2-dioxide (PubChem CID 155384257) has the molecular formula C20H36O18P2S4 and a molecular weight of 754.71 g/mol. Its IUPAC name is 4-[4-bis[(4-methyl-2,2-dioxooxathiolan-4-yl)oxy]phosphorylbutyl-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]oxy-4-methyloxathiolane 2,2-dioxide.
| Compound Name | 4-[4-bis[(4-methyl-2,2-dioxooxathiolan-4-yl)oxy]phosphorylbutyl-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]oxy-4-methyloxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 155384257 |
| Molecular Formula | C20H36O18P2S4 |
| Molecular Weight | 754.71 g/mol |
| Exact Mass | 754.03 |
| IUPAC Name | 4-[4-bis[(4-methyl-2,2-dioxooxathiolan-4-yl)oxy]phosphorylbutyl-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]oxy-4-methyloxathiolane 2,2-dioxide |
| SMILES | CC1(OP(=O)(CCCCP(=O)(OC2(C)COS(=O)(=O)C2)OC2(C)COS(=O)(=O)C2)OC2(C)COS(=O)(=O)C2)COS(=O)(=O)C1 |
| InChI | InChI=1S/C20H36O18P2S4/c1-17(9-31-41(23,24)13-17)35-39(21,36-18(2)10-32-42(25,26)14-18)7-5-6-8-40(22,37-19(3)11-33-43(27,28)15-19)38-20(4)12-34-44(29,30)16-20/h5-16H2,1-4H3 |
| InChIKey | DETGRRRRBKAGRF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 244.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.71 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|