C12H25N2O8PS2 — CID 59350881
N-[ethoxy-[(5-methyl-2,2-dioxooxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxooxathian-5-amine (PubChem CID 59350881) has the molecular formula C12H25N2O8PS2 and a molecular weight of 420.45 g/mol. Its IUPAC name is N-[ethoxy-[(5-methyl-2,2-dioxooxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxooxathian-5-amine.
| Compound Name | N-[ethoxy-[(5-methyl-2,2-dioxooxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxooxathian-5-amine |
|---|---|
| PubChem CID | 59350881 |
| Molecular Formula | C12H25N2O8PS2 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[ethoxy-[(5-methyl-2,2-dioxooxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxooxathian-5-amine |
| SMILES | CCOP(=O)(NC1(C)CCS(=O)(=O)OC1)NC1(C)CCS(=O)(=O)OC1 |
| InChI | InChI=1S/C12H25N2O8PS2/c1-4-20-23(15,13-11(2)5-7-24(16,17)21-9-11)14-12(3)6-8-25(18,19)22-10-12/h4-10H2,1-3H3,(H2,13,14,15) |
| InChIKey | TVSLRFAHLSKTCT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|