C12H24O12P2S2 — CID 155383788
4-[ethoxy-[ethoxy-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]phosphoryl]oxy-4-methyloxathiolane 2,2-dioxide (PubChem CID 155383788) has the molecular formula C12H24O12P2S2 and a molecular weight of 486.39 g/mol. Its IUPAC name is 4-[ethoxy-[ethoxy-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]phosphoryl]oxy-4-methyloxathiolane 2,2-dioxide.
| Compound Name | 4-[ethoxy-[ethoxy-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]phosphoryl]oxy-4-methyloxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 155383788 |
| Molecular Formula | C12H24O12P2S2 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 4-[ethoxy-[ethoxy-(4-methyl-2,2-dioxooxathiolan-4-yl)oxyphosphoryl]phosphoryl]oxy-4-methyloxathiolane 2,2-dioxide |
| SMILES | CCOP(=O)(OC1(C)COS(=O)(=O)C1)P(=O)(OCC)OC1(C)COS(=O)(=O)C1 |
| InChI | InChI=1S/C12H24O12P2S2/c1-5-19-25(13,23-11(3)7-21-27(15,16)9-11)26(14,20-6-2)24-12(4)8-22-28(17,18)10-12/h5-10H2,1-4H3 |
| InChIKey | JIKDAWPVMAMJLL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|