C10H21N2O10PS2 — CID 58463615
N-[ethoxy-[(5-methyl-2,2-dioxo-1,3,2-dioxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxo-1,3,2-dioxathian-5-amine (PubChem CID 58463615) has the molecular formula C10H21N2O10PS2 and a molecular weight of 424.39 g/mol. Its IUPAC name is N-[ethoxy-[(5-methyl-2,2-dioxo-1,3,2-dioxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxo-1,3,2-dioxathian-5-amine.
| Compound Name | N-[ethoxy-[(5-methyl-2,2-dioxo-1,3,2-dioxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxo-1,3,2-dioxathian-5-amine |
|---|---|
| PubChem CID | 58463615 |
| Molecular Formula | C10H21N2O10PS2 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[ethoxy-[(5-methyl-2,2-dioxo-1,3,2-dioxathian-5-yl)amino]phosphoryl]-5-methyl-2,2-dioxo-1,3,2-dioxathian-5-amine |
| SMILES | CCOP(=O)(NC1(C)COS(=O)(=O)OC1)NC1(C)COS(=O)(=O)OC1 |
| InChI | InChI=1S/C10H21N2O10PS2/c1-4-18-23(13,11-9(2)5-19-24(14,15)20-6-9)12-10(3)7-21-25(16,17)22-8-10/h4-8H2,1-3H3,(H2,11,12,13) |
| InChIKey | HJKJIZPODNOTNS-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|