C17H13ClFN3O3 — CID 155390304
2-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide (PubChem CID 155390304) has the molecular formula C17H13ClFN3O3 and a molecular weight of 361.76 g/mol. Its IUPAC name is 2-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide.
| Compound Name | 2-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 155390304 |
| Molecular Formula | C17H13ClFN3O3 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide |
| SMILES | O=C(Cc1c(-c2cc(F)c(O)c(Cl)c2)n[nH]c1-c1ccccc1)NO |
| InChI | InChI=1S/C17H13ClFN3O3/c18-12-6-10(7-13(19)17(12)24)16-11(8-14(23)22-25)15(20-21-16)9-4-2-1-3-5-9/h1-7,24-25H,8H2,(H,20,21)(H,22,23) |
| InChIKey | YLBVMQGOXNSFQG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|