C18H13ClFN3O5 — CID 155397165
3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-5-yl]benzoic acid (PubChem CID 155397165) has the molecular formula C18H13ClFN3O5 and a molecular weight of 405.77 g/mol. Its IUPAC name is 3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-5-yl]benzoic acid.
| Compound Name | 3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 155397165 |
| Molecular Formula | C18H13ClFN3O5 |
| Molecular Weight | 405.77 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-5-yl]benzoic acid |
| SMILES | O=C(Cc1c(-c2cc(F)c(O)c(Cl)c2)n[nH]c1-c1cccc(C(=O)O)c1)NO |
| InChI | InChI=1S/C18H13ClFN3O5/c19-12-5-10(6-13(20)17(12)25)16-11(7-14(24)23-28)15(21-22-16)8-2-1-3-9(4-8)18(26)27/h1-6,25,28H,7H2,(H,21,22)(H,23,24)(H,26,27) |
| InChIKey | GQXHBDYOOBBEHU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|