C17H11Cl2F2N3O4 — CID 155397189
2-[3,5-bis(4-chloro-2-fluoro-3-hydroxyphenyl)-1H-pyrazol-4-yl]-N-hydroxyacetamide (PubChem CID 155397189) has the molecular formula C17H11Cl2F2N3O4 and a molecular weight of 430.19 g/mol. Its IUPAC name is 2-[3,5-bis(4-chloro-2-fluoro-3-hydroxyphenyl)-1H-pyrazol-4-yl]-N-hydroxyacetamide.
| Compound Name | 2-[3,5-bis(4-chloro-2-fluoro-3-hydroxyphenyl)-1H-pyrazol-4-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 155397189 |
| Molecular Formula | C17H11Cl2F2N3O4 |
| Molecular Weight | 430.19 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 2-[3,5-bis(4-chloro-2-fluoro-3-hydroxyphenyl)-1H-pyrazol-4-yl]-N-hydroxyacetamide |
| SMILES | O=C(Cc1c(-c2ccc(Cl)c(O)c2F)n[nH]c1-c1ccc(Cl)c(O)c1F)NO |
| InChI | InChI=1S/C17H11Cl2F2N3O4/c18-9-3-1-6(12(20)16(9)26)14-8(5-11(25)24-28)15(23-22-14)7-2-4-10(19)17(27)13(7)21/h1-4,26-28H,5H2,(H,22,23)(H,24,25) |
| InChIKey | FESFXEOGKAMRKF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|