C18H15ClFN3O3 — CID 155390305
3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxypropanamide (PubChem CID 155390305) has the molecular formula C18H15ClFN3O3 and a molecular weight of 375.79 g/mol. Its IUPAC name is 3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxypropanamide.
| Compound Name | 3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 155390305 |
| Molecular Formula | C18H15ClFN3O3 |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 3-[3-(3-chloro-5-fluoro-4-hydroxyphenyl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxypropanamide |
| SMILES | O=C(CCc1c(-c2cc(F)c(O)c(Cl)c2)n[nH]c1-c1ccccc1)NO |
| InChI | InChI=1S/C18H15ClFN3O3/c19-13-8-11(9-14(20)18(13)25)17-12(6-7-15(24)23-26)16(21-22-17)10-4-2-1-3-5-10/h1-5,8-9,25-26H,6-7H2,(H,21,22)(H,23,24) |
| InChIKey | RSGYWTUWNCMOHK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|