About 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine
5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine (PubChem CID 155403597) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine |
| PubChem CID | 155403597 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C2=CC=NCN2C=C1 |
| InChI | InChI=1S/C16H24N2/c1-15(2,3)12-8-10-18-11-17-9-7-13(18)14(12)16(4,5)6/h7-10H,11H2,1-6H3 |
| InChIKey | AMSFUDSNDVXBRC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine?
The IUPAC name of 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine (CID 155403597) is 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine.
What is the SMILES notation for 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine?
The canonical SMILES for 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine is CC(C)(C)C1=C(C(C)(C)C)C2=CC=NCN2C=C1.
What is the InChIKey of 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine?
The InChIKey is AMSFUDSNDVXBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-15(2,3)12-8-10-18-11-17-9-7-13(18)14(12)16(4,5)6/h7-10H,11H2,1-6H3.
What are the key properties of 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine?
5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine has a molecular weight of 244.38 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-1H-pyrido[1,2-c]pyrimidine is sourced from PubChem (CID 155403597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).