C16H24N2 — CID 155649403
8,9-ditert-butyl-4H-pyrido[1,2-a]pyrazine (PubChem CID 155649403) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 8,9-ditert-butyl-4H-pyrido[1,2-a]pyrazine.
| Compound Name | 8,9-ditert-butyl-4H-pyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 155649403 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 8,9-ditert-butyl-4H-pyrido[1,2-a]pyrazine |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C2=CN=CCN2C=C1 |
| InChI | InChI=1S/C16H24N2/c1-15(2,3)12-7-9-18-10-8-17-11-13(18)14(12)16(4,5)6/h7-9,11H,10H2,1-6H3 |
| InChIKey | PUCOXQYSBCPQIH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |