C23H27ClN4O2 — CID 155410907
tert-butyl 4-[6-chloro-3-(2-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]piperidine-1-carboxylate (PubChem CID 155410907) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is tert-butyl 4-[6-chloro-3-(2-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-chloro-3-(2-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155410907 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | tert-butyl 4-[6-chloro-3-(2-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]piperidine-1-carboxylate |
| SMILES | Cc1ncccc1-c1cn(C2CCN(C(=O)OC(C)(C)C)CC2)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C23H27ClN4O2/c1-15-17(6-5-11-25-15)19-14-28(21-18(19)7-8-20(24)26-21)16-9-12-27(13-10-16)22(29)30-23(2,3)4/h5-8,11,14,16H,9-10,12-13H2,1-4H3 |
| InChIKey | CXVAJCPRIDQZOZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|