C16H15ClN4O — CID 155411835
1-(4-chloro-1H-indol-6-yl)-3-[(3-methyl-4-pyridinyl)methyl]urea (PubChem CID 155411835) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 1-(4-chloro-1H-indol-6-yl)-3-[(3-methyl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(4-chloro-1H-indol-6-yl)-3-[(3-methyl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 155411835 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(4-chloro-1H-indol-6-yl)-3-[(3-methyl-4-pyridinyl)methyl]urea |
| SMILES | Cc1cnccc1CNC(=O)Nc1cc(Cl)c2cc[nH]c2c1 |
| InChI | InChI=1S/C16H15ClN4O/c1-10-8-18-4-2-11(10)9-20-16(22)21-12-6-14(17)13-3-5-19-15(13)7-12/h2-8,19H,9H2,1H3,(H2,20,21,22) |
| InChIKey | IPSHLIGJUFHWHG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |