C20H26BrNO5 — CID 155413778
2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)phenoxy]-3-cyclobutylpropanoic acid (PubChem CID 155413778) has the molecular formula C20H26BrNO5 and a molecular weight of 440.33 g/mol. Its IUPAC name is 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)phenoxy]-3-cyclobutylpropanoic acid.
| Compound Name | 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)phenoxy]-3-cyclobutylpropanoic acid |
|---|---|
| PubChem CID | 155413778 |
| Molecular Formula | C20H26BrNO5 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)phenoxy]-3-cyclobutylpropanoic acid |
| SMILES | CCCCOC1CON=C1c1cc(Br)ccc1OC(CC1CCC1)C(=O)O |
| InChI | InChI=1S/C20H26BrNO5/c1-2-3-9-25-18-12-26-22-19(18)15-11-14(21)7-8-16(15)27-17(20(23)24)10-13-5-4-6-13/h7-8,11,13,17-18H,2-6,9-10,12H2,1H3,(H,23,24) |
| InChIKey | IKMOKHYAAKJVJN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|