C20H26ClNO5 — CID 175212739
methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]-3-cyclopropylpropanoate (PubChem CID 175212739) has the molecular formula C20H26ClNO5 and a molecular weight of 395.88 g/mol. Its IUPAC name is methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]-3-cyclopropylpropanoate.
| Compound Name | methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 175212739 |
| Molecular Formula | C20H26ClNO5 |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]-3-cyclopropylpropanoate |
| SMILES | CCCCO[C@@H]1CON=C1c1cc(Cl)ccc1O[C@@H](CC1CC1)C(=O)OC |
| InChI | InChI=1S/C20H26ClNO5/c1-3-4-9-25-18-12-26-22-19(18)15-11-14(21)7-8-16(15)27-17(20(23)24-2)10-13-5-6-13/h7-8,11,13,17-18H,3-6,9-10,12H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | ZEDCGCAELHTFHT-ZWKOTPCHSA-N |
| XLogP | 3.98 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|