C18H24ClNO5 — CID 175206538
methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]butanoate (PubChem CID 175206538) has the molecular formula C18H24ClNO5 and a molecular weight of 369.85 g/mol. Its IUPAC name is methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]butanoate.
| Compound Name | methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]butanoate |
|---|---|
| PubChem CID | 175206538 |
| Molecular Formula | C18H24ClNO5 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | methyl (2S)-2-[2-[(4S)-4-butoxy-4,5-dihydro-1,2-oxazol-3-yl]-4-chlorophenoxy]butanoate |
| SMILES | CCCCO[C@@H]1CON=C1c1cc(Cl)ccc1O[C@@H](CC)C(=O)OC |
| InChI | InChI=1S/C18H24ClNO5/c1-4-6-9-23-16-11-24-20-17(16)13-10-12(19)7-8-15(13)25-14(5-2)18(21)22-3/h7-8,10,14,16H,4-6,9,11H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | FBRZRJHSFMWHER-GOEBONIOSA-N |
| XLogP | 3.59 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|