About tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate
tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate (PubChem CID 175201392) has the molecular formula C20H27ClFNO5
and a molecular weight of 415.89 g/mol. Its IUPAC name is tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate |
| PubChem CID | 175201392 |
| Molecular Formula | C20H27ClFNO5 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate |
| SMILES | CCCCOC1CON=C1c1cc(Cl)c(F)cc1OC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27ClFNO5/c1-6-7-8-25-17-11-26-23-18(17)13-9-14(21)15(22)10-16(13)27-12(2)19(24)28-20(3,4)5/h9-10,12,17H,6-8,11H2,1-5H3 |
| InChIKey | ZLAGGBFIYLPMQP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate?
The IUPAC name of tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate (CID 175201392) is tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate.
What is the SMILES notation for tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate?
The canonical SMILES for tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate is CCCCOC1CON=C1c1cc(Cl)c(F)cc1OC(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate?
The InChIKey is ZLAGGBFIYLPMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27ClFNO5/c1-6-7-8-25-17-11-26-23-18(17)13-9-14(21)15(22)10-16(13)27-12(2)19(24)28-20(3,4)5/h9-10,12,17H,6-8,11H2,1-5H3.
What are the key properties of tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate?
tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate has a molecular weight of 415.89 g/mol, XLogP of 4.51, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4-chloro-5-fluorophenoxy]propanoate is sourced from PubChem (CID 175201392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).