C16H19Cl2NO5 — CID 155414370
(2S)-2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4,5-dichlorophenoxy]propanoic acid (PubChem CID 155414370) has the molecular formula C16H19Cl2NO5 and a molecular weight of 376.24 g/mol. Its IUPAC name is (2S)-2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4,5-dichlorophenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4,5-dichlorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 155414370 |
| Molecular Formula | C16H19Cl2NO5 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (2S)-2-[2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-4,5-dichlorophenoxy]propanoic acid |
| SMILES | CCCCOC1CON=C1c1cc(Cl)c(Cl)cc1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C16H19Cl2NO5/c1-3-4-5-22-14-8-23-19-15(14)10-6-11(17)12(18)7-13(10)24-9(2)16(20)21/h6-7,9,14H,3-5,8H2,1-2H3,(H,20,21)/t9-,14?/m0/s1 |
| InChIKey | LOJMGIUQKCBKIO-CUVJYRNJSA-N |
| XLogP | 3.76 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|