C10H7F15 — CID 155426973
1,1,1,7,7,7-hexafluoro-3,4,5-tris(trifluoromethyl)heptane (PubChem CID 155426973) has the molecular formula C10H7F15 and a molecular weight of 412.14 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoro-3,4,5-tris(trifluoromethyl)heptane.
| Compound Name | 1,1,1,7,7,7-hexafluoro-3,4,5-tris(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 155426973 |
| Molecular Formula | C10H7F15 |
| Molecular Weight | 412.14 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoro-3,4,5-tris(trifluoromethyl)heptane |
| SMILES | FC(F)(F)CC(C(C(CC(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7F15/c11-6(12,13)1-3(8(17,18)19)5(10(23,24)25)4(9(20,21)22)2-7(14,15)16/h3-5H,1-2H2 |
| InChIKey | NULMMFDUTJPZHP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.14 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |