C12H13Cl2N3O — CID 15544994
5-amino-4-(2,6-dichlorophenyl)-2-propan-2-yl-1H-pyrazol-3-one (PubChem CID 15544994) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 5-amino-4-(2,6-dichlorophenyl)-2-propan-2-yl-1H-pyrazol-3-one.
| Compound Name | 5-amino-4-(2,6-dichlorophenyl)-2-propan-2-yl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 15544994 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-amino-4-(2,6-dichlorophenyl)-2-propan-2-yl-1H-pyrazol-3-one |
| SMILES | CC(C)n1[nH]c(N)c(-c2c(Cl)cccc2Cl)c1=O |
| InChI | InChI=1S/C12H13Cl2N3O/c1-6(2)17-12(18)10(11(15)16-17)9-7(13)4-3-5-8(9)14/h3-6,16H,15H2,1-2H3 |
| InChIKey | CVNOOQNRWBFVCB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |