C17H25NO8 — CID 155454380
[(2R,3R,6S,7S)-6-acetamido-3,5-diacetyloxy-7-ethyl-2,3,6,7-tetrahydrooxepin-2-yl]methyl acetate (PubChem CID 155454380) has the molecular formula C17H25NO8 and a molecular weight of 371.39 g/mol. Its IUPAC name is [(2R,3R,6S,7S)-6-acetamido-3,5-diacetyloxy-7-ethyl-2,3,6,7-tetrahydrooxepin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,6S,7S)-6-acetamido-3,5-diacetyloxy-7-ethyl-2,3,6,7-tetrahydrooxepin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155454380 |
| Molecular Formula | C17H25NO8 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [(2R,3R,6S,7S)-6-acetamido-3,5-diacetyloxy-7-ethyl-2,3,6,7-tetrahydrooxepin-2-yl]methyl acetate |
| SMILES | CC[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)C=C(OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H25NO8/c1-6-13-17(18-9(2)19)15(25-12(5)22)7-14(24-11(4)21)16(26-13)8-23-10(3)20/h7,13-14,16-17H,6,8H2,1-5H3,(H,18,19)/t13-,14+,16+,17-/m0/s1 |
| InChIKey | VDIWKNIBKQTOOG-ABFRBSLYSA-N |
| XLogP | 0.61 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|