C20H32O8 — CID 25170303
[(2R,3S,6S)-3,5-diacetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 25170303) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(2R,3S,6S)-3,5-diacetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3,5-diacetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 25170303 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(2R,3S,6S)-3,5-diacetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCCCCCCCO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)C=C1OC(C)=O |
| InChI | InChI=1S/C20H32O8/c1-5-6-7-8-9-10-11-24-20-18(27-16(4)23)12-17(26-15(3)22)19(28-20)13-25-14(2)21/h12,17,19-20H,5-11,13H2,1-4H3/t17-,19+,20-/m0/s1 |
| InChIKey | RFBWGGKSAYKIHS-SXLOBPIMSA-N |
| XLogP | 3.03 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|