C17H19N3 — CID 155461665
9-ethenyl-7-methyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-6a-amine (PubChem CID 155461665) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 9-ethenyl-7-methyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-6a-amine.
| Compound Name | 9-ethenyl-7-methyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-6a-amine |
|---|---|
| PubChem CID | 155461665 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 9-ethenyl-7-methyl-4,6,8,9-tetrahydroindolo[4,3-fg]quinolin-6a-amine |
| SMILES | C=CC1C=C2c3cccc4[nH]cc(c34)CC2(N)N(C)C1 |
| InChI | InChI=1S/C17H19N3/c1-3-11-7-14-13-5-4-6-15-16(13)12(9-19-15)8-17(14,18)20(2)10-11/h3-7,9,11,19H,1,8,10,18H2,2H3 |
| InChIKey | JKNUEBKYDDGENG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|