C23H46O3 — CID 155468443
2,2,4,4,5,5,6-heptamethyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]heptan-3-one (PubChem CID 155468443) has the molecular formula C23H46O3 and a molecular weight of 370.62 g/mol. Its IUPAC name is 2,2,4,4,5,5,6-heptamethyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]heptan-3-one.
| Compound Name | 2,2,4,4,5,5,6-heptamethyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]heptan-3-one |
|---|---|
| PubChem CID | 155468443 |
| Molecular Formula | C23H46O3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.34 |
| IUPAC Name | 2,2,4,4,5,5,6-heptamethyl-6-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]heptan-3-one |
| SMILES | CC(C)(C)OC(C)(C)CCOC(C)(C)C(C)(C)C(C)(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C23H46O3/c1-18(2,3)17(24)21(9,10)22(11,12)23(13,14)25-16-15-20(7,8)26-19(4,5)6/h15-16H2,1-14H3 |
| InChIKey | RUQZREYQDQZMHM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |