C49H42N4S — CID 155470733
[amino-[4-(2-phenyl-4-spiro[7,8-dihydrofluorene-9,9'-fluorene]-2-yl-1,4-dihydropyrimidin-6-yl)cyclohexa-1,5-dien-1-yl]methyl] cyclohexa-1,5-diene-1-carboximidothioate (PubChem CID 155470733) has the molecular formula C49H42N4S and a molecular weight of 718.97 g/mol. Its IUPAC name is [amino-[4-(2-phenyl-4-spiro[7,8-dihydrofluorene-9,9'-fluorene]-2-yl-1,4-dihydropyrimidin-6-yl)cyclohexa-1,5-dien-1-yl]methyl] cyclohexa-1,5-diene-1-carboximidothioate.
| Compound Name | [amino-[4-(2-phenyl-4-spiro[7,8-dihydrofluorene-9,9'-fluorene]-2-yl-1,4-dihydropyrimidin-6-yl)cyclohexa-1,5-dien-1-yl]methyl] cyclohexa-1,5-diene-1-carboximidothioate |
|---|---|
| PubChem CID | 155470733 |
| Molecular Formula | C49H42N4S |
| Molecular Weight | 718.97 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | [amino-[4-(2-phenyl-4-spiro[7,8-dihydrofluorene-9,9'-fluorene]-2-yl-1,4-dihydropyrimidin-6-yl)cyclohexa-1,5-dien-1-yl]methyl] cyclohexa-1,5-diene-1-carboximidothioate |
| SMILES | [H]/N=C(/SC(N)C1=CCC(C2=CC(c3ccc4c(c3)C3(C5=C4C=CCC5)c4ccccc4-c4ccccc43)N=C(c3ccccc3)N2)C=C1)C1=CCCC=C1 |
| InChI | InChI=1S/C49H42N4S/c50-46(32-13-3-1-4-14-32)54-47(51)33-25-23-31(24-26-33)44-30-45(53-48(52-44)34-15-5-2-6-16-34)35-27-28-39-38-19-9-12-22-42(38)49(43(39)29-35)40-20-10-7-17-36(40)37-18-8-11-21-41(37)49/h2-3,5-11,13-21,23,25-31,45,47,50H,1,4,12,22,24,51H2,(H,52,53)/b50-46+ |
| InChIKey | LYPCNYWQFMMHQX-DTXUWMCOSA-N |
| XLogP | 10.87 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.97 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|