C48H46N4S — CID 155470452
[amino-[2-[2-cyclohexa-1,5-dien-1-yl-4-[3-(4-phenyl-4,4a,5,6-tetrahydronaphthalen-1-yl)phenyl]-1,4-dihydropyrimidin-6-yl]phenyl]methyl] 3,5-dimethylbenzenecarboximidothioate (PubChem CID 155470452) has the molecular formula C48H46N4S and a molecular weight of 710.99 g/mol. Its IUPAC name is [amino-[2-[2-cyclohexa-1,5-dien-1-yl-4-[3-(4-phenyl-4,4a,5,6-tetrahydronaphthalen-1-yl)phenyl]-1,4-dihydropyrimidin-6-yl]phenyl]methyl] 3,5-dimethylbenzenecarboximidothioate.
| Compound Name | [amino-[2-[2-cyclohexa-1,5-dien-1-yl-4-[3-(4-phenyl-4,4a,5,6-tetrahydronaphthalen-1-yl)phenyl]-1,4-dihydropyrimidin-6-yl]phenyl]methyl] 3,5-dimethylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 155470452 |
| Molecular Formula | C48H46N4S |
| Molecular Weight | 710.99 g/mol |
| Exact Mass | 710.34 |
| IUPAC Name | [amino-[2-[2-cyclohexa-1,5-dien-1-yl-4-[3-(4-phenyl-4,4a,5,6-tetrahydronaphthalen-1-yl)phenyl]-1,4-dihydropyrimidin-6-yl]phenyl]methyl] 3,5-dimethylbenzenecarboximidothioate |
| SMILES | [H]/N=C(/SC(N)c1ccccc1C1=CC(c2cccc(C3=C4C=CCCC4C(c4ccccc4)C=C3)c2)N=C(C2=CCCC=C2)N1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C48H46N4S/c1-31-26-32(2)28-37(27-31)46(49)53-47(50)43-23-12-11-22-42(43)45-30-44(51-48(52-45)34-16-7-4-8-17-34)36-19-13-18-35(29-36)39-25-24-38(33-14-5-3-6-15-33)40-20-9-10-21-41(39)40/h3,5-7,10-19,21-30,38,40,44,47,49H,4,8-9,20,50H2,1-2H3,(H,51,52)/b49-46+ |
| InChIKey | ZWPRDUWHBMFNOC-IDXZSWHRSA-N |
| XLogP | 11.45 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.99 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|