C44H34N4S — CID 155470658
[amino-[4-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydropyrimidin-6-yl]methyl] benzenecarboximidothioate (PubChem CID 155470658) has the molecular formula C44H34N4S and a molecular weight of 650.85 g/mol. Its IUPAC name is [amino-[4-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydropyrimidin-6-yl]methyl] benzenecarboximidothioate.
| Compound Name | [amino-[4-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydropyrimidin-6-yl]methyl] benzenecarboximidothioate |
|---|---|
| PubChem CID | 155470658 |
| Molecular Formula | C44H34N4S |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | [amino-[4-phenyl-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydropyrimidin-6-yl]methyl] benzenecarboximidothioate |
| SMILES | [H]/N=C(/SC(N)C1=CC(c2ccccc2)N=C(c2ccc(-c3c4ccccc4c(-c4ccccc4)c4ccccc34)cc2)N1)c1ccccc1 |
| InChI | InChI=1S/C44H34N4S/c45-42(32-18-8-3-9-19-32)49-43(46)39-28-38(29-14-4-1-5-15-29)47-44(48-39)33-26-24-31(25-27-33)41-36-22-12-10-20-34(36)40(30-16-6-2-7-17-30)35-21-11-13-23-37(35)41/h1-28,38,43,45H,46H2,(H,47,48)/b45-42+ |
| InChIKey | UWJZDDVNSXJACK-NYHNVNJYSA-N |
| XLogP | 10.35 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|