C45H34N4O — CID 167485476
1,3-dimethyl-5-[3-[2-phenyl-4-(10-phenylanthracen-9-yl)-1,4-dihydropyrimidin-6-yl]phenyl]benzimidazol-2-one (PubChem CID 167485476) has the molecular formula C45H34N4O and a molecular weight of 646.79 g/mol. Its IUPAC name is 1,3-dimethyl-5-[3-[2-phenyl-4-(10-phenylanthracen-9-yl)-1,4-dihydropyrimidin-6-yl]phenyl]benzimidazol-2-one.
| Compound Name | 1,3-dimethyl-5-[3-[2-phenyl-4-(10-phenylanthracen-9-yl)-1,4-dihydropyrimidin-6-yl]phenyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 167485476 |
| Molecular Formula | C45H34N4O |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | 1,3-dimethyl-5-[3-[2-phenyl-4-(10-phenylanthracen-9-yl)-1,4-dihydropyrimidin-6-yl]phenyl]benzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3cccc(C4=CC(c5c6ccccc6c(-c6ccccc6)c6ccccc56)N=C(c5ccccc5)N4)c3)ccc21 |
| InChI | InChI=1S/C45H34N4O/c1-48-40-25-24-32(27-41(40)49(2)45(48)50)31-18-13-19-33(26-31)38-28-39(47-44(46-38)30-16-7-4-8-17-30)43-36-22-11-9-20-34(36)42(29-14-5-3-6-15-29)35-21-10-12-23-37(35)43/h3-28,39H,1-2H3,(H,46,47) |
| InChIKey | ZISWPXWNYIDXPD-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|