C32H33NO7 — CID 155480859
N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-(3-methylphenyl)benzamide (PubChem CID 155480859) has the molecular formula C32H33NO7 and a molecular weight of 543.62 g/mol. Its IUPAC name is N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-(3-methylphenyl)benzamide.
| Compound Name | N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 155480859 |
| Molecular Formula | C32H33NO7 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-(3-methylphenyl)benzamide |
| SMILES | COC1CC[C@H](Oc2ccc3c(O)c(NC(=O)c4cccc(-c5cccc(C)c5)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C32H33NO7/c1-18-8-6-9-20(16-18)21-10-7-11-22(17-21)30(35)33-27-28(34)23-12-13-24(19(2)29(23)39-31(27)36)38-26-15-14-25(37-5)32(3,4)40-26/h6-13,16-17,25-26,34H,14-15H2,1-5H3,(H,33,35)/t25?,26-/m1/s1 |
| InChIKey | HLCSAFXCEKOFEV-FXDYGKIASA-N |
| XLogP | 6.34 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|