C31H32N2O7 — CID 155480870
3-anilino-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide (PubChem CID 155480870) has the molecular formula C31H32N2O7 and a molecular weight of 544.60 g/mol. Its IUPAC name is 3-anilino-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide.
| Compound Name | 3-anilino-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide |
|---|---|
| PubChem CID | 155480870 |
| Molecular Formula | C31H32N2O7 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 3-anilino-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide |
| SMILES | COC1CC[C@H](Oc2ccc3c(O)c(NC(=O)c4cccc(Nc5ccccc5)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C31H32N2O7/c1-18-23(38-25-16-15-24(37-4)31(2,3)40-25)14-13-22-27(34)26(30(36)39-28(18)22)33-29(35)19-9-8-12-21(17-19)32-20-10-6-5-7-11-20/h5-14,17,24-25,32,34H,15-16H2,1-4H3,(H,33,35)/t24?,25-/m1/s1 |
| InChIKey | XXYLPHSAEJZJEL-WUBHUQEYSA-N |
| XLogP | 6.11 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|