C14H27N — CID 155485839
N,4-dimethyl-N-(3-methylbutyl)hept-1-yn-1-amine (PubChem CID 155485839) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is N,4-dimethyl-N-(3-methylbutyl)hept-1-yn-1-amine.
| Compound Name | N,4-dimethyl-N-(3-methylbutyl)hept-1-yn-1-amine |
|---|---|
| PubChem CID | 155485839 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | N,4-dimethyl-N-(3-methylbutyl)hept-1-yn-1-amine |
| SMILES | CCCC(C)CC#CN(C)CCC(C)C |
| InChI | InChI=1S/C14H27N/c1-6-8-14(4)9-7-11-15(5)12-10-13(2)3/h13-14H,6,8-10,12H2,1-5H3 |
| InChIKey | LTAKBNSHBQLFPS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|