C22H16N8O2S2 — CID 155490752
(E)-N-[3-[[1-(4-nitrophenyl)triazol-4-yl]methylsulfanyl]-5-phenyl-1,2,4-triazol-4-yl]-1-thiophen-2-ylmethanimine (PubChem CID 155490752) has the molecular formula C22H16N8O2S2 and a molecular weight of 488.56 g/mol. Its IUPAC name is (E)-N-[3-[[1-(4-nitrophenyl)triazol-4-yl]methylsulfanyl]-5-phenyl-1,2,4-triazol-4-yl]-1-thiophen-2-ylmethanimine.
| Compound Name | (E)-N-[3-[[1-(4-nitrophenyl)triazol-4-yl]methylsulfanyl]-5-phenyl-1,2,4-triazol-4-yl]-1-thiophen-2-ylmethanimine |
|---|---|
| PubChem CID | 155490752 |
| Molecular Formula | C22H16N8O2S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | (E)-N-[3-[[1-(4-nitrophenyl)triazol-4-yl]methylsulfanyl]-5-phenyl-1,2,4-triazol-4-yl]-1-thiophen-2-ylmethanimine |
| SMILES | O=[N+]([O-])c1ccc(-n2cc(CSc3nnc(-c4ccccc4)n3/N=C/c3cccs3)nn2)cc1 |
| InChI | InChI=1S/C22H16N8O2S2/c31-30(32)19-10-8-18(9-11-19)28-14-17(24-27-28)15-34-22-26-25-21(16-5-2-1-3-6-16)29(22)23-13-20-7-4-12-33-20/h1-14H,15H2/b23-13+ |
| InChIKey | JOSHVNNSCLXXPE-YDZHTSKRSA-N |
| XLogP | 4.67 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|